C25H27NO7 — CID 161440852
tert-butyl N-[6-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-6-oxohexyl]carbamate (PubChem CID 161440852) has the molecular formula C25H27NO7 and a molecular weight of 453.49 g/mol. Its IUPAC name is tert-butyl N-[6-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 161440852 |
| Molecular Formula | C25H27NO7 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | tert-butyl N-[6-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-6-oxohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C25H27NO7/c1-25(2,3)33-24(32)26-11-6-4-5-9-17(27)14-12-16-21(19(29)13-14)23(31)20-15(22(16)30)8-7-10-18(20)28/h7-8,10,12-13,28-29H,4-6,9,11H2,1-3H3,(H,26,32) |
| InChIKey | RQDASBQFPOIQSG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|