C32H40O10 — CID 160602880
tert-butyl 5-[2-[2-[5-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-5-oxopentoxy]ethoxy]ethoxy]pentanoate (PubChem CID 160602880) has the molecular formula C32H40O10 and a molecular weight of 584.66 g/mol. Its IUPAC name is tert-butyl 5-[2-[2-[5-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-5-oxopentoxy]ethoxy]ethoxy]pentanoate.
| Compound Name | tert-butyl 5-[2-[2-[5-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-5-oxopentoxy]ethoxy]ethoxy]pentanoate |
|---|---|
| PubChem CID | 160602880 |
| Molecular Formula | C32H40O10 |
| Molecular Weight | 584.66 g/mol |
| Exact Mass | 584.26 |
| IUPAC Name | tert-butyl 5-[2-[2-[5-(4,5-dihydroxy-9,10-dioxoanthracen-2-yl)-5-oxopentoxy]ethoxy]ethoxy]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCCOCCOCCOCCCCC(=O)c1cc(O)c2c(c1)C(=O)c1cccc(O)c1C2=O |
| InChI | InChI=1S/C32H40O10/c1-32(2,3)42-27(36)12-5-7-14-40-16-18-41-17-15-39-13-6-4-10-24(33)21-19-23-29(26(35)20-21)31(38)28-22(30(23)37)9-8-11-25(28)34/h8-9,11,19-20,34-35H,4-7,10,12-18H2,1-3H3 |
| InChIKey | KLELMSCFUFCQEQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.66 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|