C28H32O7 — CID 73212561
(6aR)-3-[(4S)-4-hydroxy-2-methyl-6-oxocyclohexen-1-yl]-6a-methyl-9-[(2S)-2-methyloctanoyl]furo[2,3-h]isochromene-6,8-dione (PubChem CID 73212561) has the molecular formula C28H32O7 and a molecular weight of 480.56 g/mol. Its IUPAC name is (6aR)-3-[(4S)-4-hydroxy-2-methyl-6-oxocyclohexen-1-yl]-6a-methyl-9-[(2S)-2-methyloctanoyl]furo[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aR)-3-[(4S)-4-hydroxy-2-methyl-6-oxocyclohexen-1-yl]-6a-methyl-9-[(2S)-2-methyloctanoyl]furo[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 73212561 |
| Molecular Formula | C28H32O7 |
| Molecular Weight | 480.56 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | (6aR)-3-[(4S)-4-hydroxy-2-methyl-6-oxocyclohexen-1-yl]-6a-methyl-9-[(2S)-2-methyloctanoyl]furo[2,3-h]isochromene-6,8-dione |
| SMILES | CCCCCC[C@H](C)C(=O)C1=C2C3=COC(C4=C(C)C[C@H](O)CC4=O)=CC3=CC(=O)[C@]2(C)OC1=O |
| InChI | InChI=1S/C28H32O7/c1-5-6-7-8-9-15(2)26(32)24-25-19-14-34-21(23-16(3)10-18(29)13-20(23)30)11-17(19)12-22(31)28(25,4)35-27(24)33/h11-12,14-15,18,29H,5-10,13H2,1-4H3/t15-,18-,28-/m0/s1 |
| InChIKey | LFNOEQKIIMCRRH-YIQPMRTKSA-N |
| XLogP | 4.12 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.56 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|