C16H24NO3- — CID 7321356
(3R)-5-(1-adamantylamino)-3-methyl-5-oxopentanoate (PubChem CID 7321356) has the molecular formula C16H24NO3- and a molecular weight of 278.37 g/mol. Its IUPAC name is (3R)-5-(1-adamantylamino)-3-methyl-5-oxopentanoate.
| Compound Name | (3R)-5-(1-adamantylamino)-3-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 7321356 |
| Molecular Formula | C16H24NO3- |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (3R)-5-(1-adamantylamino)-3-methyl-5-oxopentanoate |
| SMILES | C[C@@H](CC(=O)[O-])CC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H25NO3/c1-10(3-15(19)20)2-14(18)17-16-7-11-4-12(8-16)6-13(5-11)9-16/h10-13H,2-9H2,1H3,(H,17,18)(H,19,20)/p-1/t10-,11?,12?,13?,16?/m1/s1 |
| InChIKey | QVJLTJZUADLGRZ-GYPVXTSCSA-M |
| XLogP | 1.24 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |