C30H45NO7S — CID 73214283
4-[4-[(3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]benzenesulfonic acid (PubChem CID 73214283) has the molecular formula C30H45NO7S and a molecular weight of 563.76 g/mol. Its IUPAC name is 4-[4-[(3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]benzenesulfonic acid.
| Compound Name | 4-[4-[(3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 73214283 |
| Molecular Formula | C30H45NO7S |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 4-[4-[(3R,7R,10S,12S,13R,17R)-3,7,12-trihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoylamino]benzenesulfonic acid |
| SMILES | CC(CCC(=O)Nc1ccc(S(=O)(=O)O)cc1)[C@H]1CCC2C3C(O)CC4C[C@H](O)CC[C@]4(C)C3C[C@H](O)[C@@]21C |
| InChI | InChI=1S/C30H45NO7S/c1-17(4-11-27(35)31-19-5-7-21(8-6-19)39(36,37)38)22-9-10-23-28-24(16-26(34)30(22,23)3)29(2)13-12-20(32)14-18(29)15-25(28)33/h5-8,17-18,20,22-26,28,32-34H,4,9-16H2,1-3H3,(H,31,35)(H,36,37,38)/t17?,18?,20-,22-,23?,24?,25?,26+,28?,29+,30-/m1/s1 |
| InChIKey | XLTXIVZUTWPSPJ-YSQMZTLESA-N |
| XLogP | 4.25 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|