C18H25N3O3 — CID 73215559
N-butan-2-yl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide (PubChem CID 73215559) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is N-butan-2-yl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide.
| Compound Name | N-butan-2-yl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 73215559 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | N-butan-2-yl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
| SMILES | CCCCCN1C(=O)N=C2C=C(C(=O)NC(C)CC)C=CC2C1=O |
| InChI | InChI=1S/C18H25N3O3/c1-4-6-7-10-21-17(23)14-9-8-13(11-15(14)20-18(21)24)16(22)19-12(3)5-2/h8-9,11-12,14H,4-7,10H2,1-3H3,(H,19,22) |
| InChIKey | YJSMYUWNAZBOIQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|