C19H25N3O3 — CID 73216984
N-cyclopentyl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide (PubChem CID 73216984) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N-cyclopentyl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide.
| Compound Name | N-cyclopentyl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 73216984 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N-cyclopentyl-2,4-dioxo-3-pentyl-4aH-quinazoline-7-carboxamide |
| SMILES | CCCCCN1C(=O)N=C2C=C(C(=O)NC3CCCC3)C=CC2C1=O |
| InChI | InChI=1S/C19H25N3O3/c1-2-3-6-11-22-18(24)15-10-9-13(12-16(15)21-19(22)25)17(23)20-14-7-4-5-8-14/h9-10,12,14-15H,2-8,11H2,1H3,(H,20,23) |
| InChIKey | RGONFYBIBMBOAT-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|