C17H23N3O3 — CID 73218151
2,4-dioxo-3-pentyl-N-propan-2-yl-4aH-quinazoline-7-carboxamide (PubChem CID 73218151) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 2,4-dioxo-3-pentyl-N-propan-2-yl-4aH-quinazoline-7-carboxamide.
| Compound Name | 2,4-dioxo-3-pentyl-N-propan-2-yl-4aH-quinazoline-7-carboxamide |
|---|---|
| PubChem CID | 73218151 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2,4-dioxo-3-pentyl-N-propan-2-yl-4aH-quinazoline-7-carboxamide |
| SMILES | CCCCCN1C(=O)N=C2C=C(C(=O)NC(C)C)C=CC2C1=O |
| InChI | InChI=1S/C17H23N3O3/c1-4-5-6-9-20-16(22)13-8-7-12(15(21)18-11(2)3)10-14(13)19-17(20)23/h7-8,10-11,13H,4-6,9H2,1-3H3,(H,18,21) |
| InChIKey | OMQJEGXTTIZPIZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|