C22H27NO5 — CID 73220400
1-(3-hydroxyphenyl)-2-(2-methoxyethyl)-6,8-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73220400) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-2-(2-methoxyethyl)-6,8-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3-hydroxyphenyl)-2-(2-methoxyethyl)-6,8-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73220400 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-(3-hydroxyphenyl)-2-(2-methoxyethyl)-6,8-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCN1C(=O)C2=C(C(=O)C3C(C)CC(C)CC3O2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C22H27NO5/c1-12-9-13(2)17-16(10-12)28-21-18(20(17)25)19(14-5-4-6-15(24)11-14)23(22(21)26)7-8-27-3/h4-6,11-13,16-17,19,24H,7-10H2,1-3H3 |
| InChIKey | JUUIHXFTEGCRHD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |