C28H39NO6 — CID 74685362
2-(2-methoxyethyl)-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74685362) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol. Its IUPAC name is 2-(2-methoxyethyl)-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(2-methoxyethyl)-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74685362 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | 2-(2-methoxyethyl)-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COCCN1C(=O)C2=C(C(=O)C3CC(C)C(C)CC3O2)C1c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C28H39NO6/c1-16(2)9-11-34-21-8-7-19(15-23(21)33-6)25-24-26(30)20-13-17(3)18(4)14-22(20)35-27(24)28(31)29(25)10-12-32-5/h7-8,15-18,20,22,25H,9-14H2,1-6H3 |
| InChIKey | PXQUGIYVNBLACR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |