C27H37NO5 — CID 73261130
2-butyl-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73261130) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is 2-butyl-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-butyl-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73261130 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | 2-butyl-1-[3-methoxy-4-(3-methylbutoxy)phenyl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCN1C(=O)C2=C(C(=O)C3CCCCC3O2)C1c1ccc(OCCC(C)C)c(OC)c1 |
| InChI | InChI=1S/C27H37NO5/c1-5-6-14-28-24(18-11-12-21(22(16-18)31-4)32-15-13-17(2)3)23-25(29)19-9-7-8-10-20(19)33-26(23)27(28)30/h11-12,16-17,19-20,24H,5-10,13-15H2,1-4H3 |
| InChIKey | NJTZMLOCRGRSME-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |