C28H29NO7 — CID 78263924
2-(1,3-benzodioxol-5-ylmethyl)-1-(4-ethoxy-3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78263924) has the molecular formula C28H29NO7 and a molecular weight of 491.54 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-ethoxy-3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-ethoxy-3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78263924 |
| Molecular Formula | C28H29NO7 |
| Molecular Weight | 491.54 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(4-ethoxy-3-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1ccc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2Cc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C28H29NO7/c1-3-33-20-11-9-17(13-22(20)32-2)25-24-26(30)18-6-4-5-7-19(18)36-27(24)28(31)29(25)14-16-8-10-21-23(12-16)35-15-34-21/h8-13,18-19,25H,3-7,14-15H2,1-2H3 |
| InChIKey | KYDCURWNDHNDIV-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.54 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |