C27H27NO6 — CID 78261483
2-(1,3-benzodioxol-5-ylmethyl)-1-(3-methoxyphenyl)-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78261483) has the molecular formula C27H27NO6 and a molecular weight of 461.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-methoxyphenyl)-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-methoxyphenyl)-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78261483 |
| Molecular Formula | C27H27NO6 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-methoxyphenyl)-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1cccc(C2C3=C(OC4CCC(C)CC4C3=O)C(=O)N2Cc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C27H27NO6/c1-15-6-8-20-19(10-15)25(29)23-24(17-4-3-5-18(12-17)31-2)28(27(30)26(23)34-20)13-16-7-9-21-22(11-16)33-14-32-21/h3-5,7,9,11-12,15,19-20,24H,6,8,10,13-14H2,1-2H3 |
| InChIKey | JOYPZTDLAOPQLL-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |