C27H29NO6 — CID 78261592
1-(4-hydroxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78261592) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 1-(4-hydroxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-hydroxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78261592 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 1-(4-hydroxy-3-methoxyphenyl)-2-[(4-methoxyphenyl)methyl]-7-methyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(CN2C(=O)C3=C(C(=O)C4CC(C)CCC4O3)C2c2ccc(O)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H29NO6/c1-15-4-11-21-19(12-15)25(30)23-24(17-7-10-20(29)22(13-17)33-3)28(27(31)26(23)34-21)14-16-5-8-18(32-2)9-6-16/h5-10,13,15,19,21,24,29H,4,11-12,14H2,1-3H3 |
| InChIKey | WDODJNUTGZEVBS-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |