C20H23NO4 — CID 78328338
1-(4-methoxyphenyl)-2,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78328338) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-methoxyphenyl)-2,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78328338 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(C2C3=C(OC4CCC(C)CC4C3=O)C(=O)N2C)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-11-4-9-15-14(10-11)18(22)16-17(21(2)20(23)19(16)25-15)12-5-7-13(24-3)8-6-12/h5-8,11,14-15,17H,4,9-10H2,1-3H3 |
| InChIKey | KIURDPIHSGOTJF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |