C26H26FNO4S — CID 78224278
7-fluoro-2-[(4-methoxyphenyl)methyl]-1-(4-methylsulfanylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78224278) has the molecular formula C26H26FNO4S and a molecular weight of 467.56 g/mol. Its IUPAC name is 7-fluoro-2-[(4-methoxyphenyl)methyl]-1-(4-methylsulfanylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-2-[(4-methoxyphenyl)methyl]-1-(4-methylsulfanylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78224278 |
| Molecular Formula | C26H26FNO4S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 7-fluoro-2-[(4-methoxyphenyl)methyl]-1-(4-methylsulfanylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(CN2C(=O)C3=C(C(=O)C4CC(F)CCC4O3)C2c2ccc(SC)cc2)cc1 |
| InChI | InChI=1S/C26H26FNO4S/c1-31-18-8-3-15(4-9-18)14-28-23(16-5-10-19(33-2)11-6-16)22-24(29)20-13-17(27)7-12-21(20)32-25(22)26(28)30/h3-6,8-11,17,20-21,23H,7,12-14H2,1-2H3 |
| InChIKey | NHTDVVCEUAGCKM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |