C27H27NO7 — CID 74685409
2-(1,3-benzodioxol-5-ylmethyl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74685409) has the molecular formula C27H27NO7 and a molecular weight of 477.51 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74685409 |
| Molecular Formula | C27H27NO7 |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.18 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1cc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2Cc2ccc3c(c2)OCO3)ccc1O |
| InChI | InChI=1S/C27H27NO7/c1-2-32-21-12-16(8-9-18(21)29)24-23-25(30)17-5-3-4-6-19(17)35-26(23)27(31)28(24)13-15-7-10-20-22(11-15)34-14-33-20/h7-12,17,19,24,29H,2-6,13-14H2,1H3 |
| InChIKey | VZLVQYUJDWPHAE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |