C28H28N2O6S — CID 78249392
2-(6-ethoxy-1,3-benzothiazol-2-yl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78249392) has the molecular formula C28H28N2O6S and a molecular weight of 520.61 g/mol. Its IUPAC name is 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78249392 |
| Molecular Formula | C28H28N2O6S |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 2-(6-ethoxy-1,3-benzothiazol-2-yl)-1-(3-ethoxy-4-hydroxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCOc1ccc2nc(N3C(=O)C4=C(C(=O)C5CCCCC5O4)C3c3ccc(O)c(OCC)c3)sc2c1 |
| InChI | InChI=1S/C28H28N2O6S/c1-3-34-16-10-11-18-22(14-16)37-28(29-18)30-24(15-9-12-19(31)21(13-15)35-4-2)23-25(32)17-7-5-6-8-20(17)36-26(23)27(30)33/h9-14,17,20,24,31H,3-8H2,1-2H3 |
| InChIKey | SPVBRGGUMUOOGG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 98.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |