C28H26N2O5S — CID 78247367
methyl 4-[2-(6-ethyl-1,3-benzothiazol-2-yl)-3,9-dioxo-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate (PubChem CID 78247367) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is methyl 4-[2-(6-ethyl-1,3-benzothiazol-2-yl)-3,9-dioxo-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[2-(6-ethyl-1,3-benzothiazol-2-yl)-3,9-dioxo-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 78247367 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | methyl 4-[2-(6-ethyl-1,3-benzothiazol-2-yl)-3,9-dioxo-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
| SMILES | CCc1ccc2nc(N3C(=O)C4=C(C(=O)C5CCCCC5O4)C3c3ccc(C(=O)OC)cc3)sc2c1 |
| InChI | InChI=1S/C28H26N2O5S/c1-3-15-8-13-19-21(14-15)36-28(29-19)30-23(16-9-11-17(12-10-16)27(33)34-2)22-24(31)18-6-4-5-7-20(18)35-25(22)26(30)32/h8-14,18,20,23H,3-7H2,1-2H3 |
| InChIKey | CRVLVPABDPMFTE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |