C24H18ClFN2O3S — CID 74742781
2-(6-chloro-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74742781) has the molecular formula C24H18ClFN2O3S and a molecular weight of 468.94 g/mol. Its IUPAC name is 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74742781 |
| Molecular Formula | C24H18ClFN2O3S |
| Molecular Weight | 468.94 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2-(6-chloro-1,3-benzothiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | O=C1C2=C(OC3CCCCC13)C(=O)N(c1nc3ccc(Cl)cc3s1)C2c1cccc(F)c1 |
| InChI | InChI=1S/C24H18ClFN2O3S/c25-13-8-9-16-18(11-13)32-24(27-16)28-20(12-4-3-5-14(26)10-12)19-21(29)15-6-1-2-7-17(15)31-22(19)23(28)30/h3-5,8-11,15,17,20H,1-2,6-7H2 |
| InChIKey | ULCDHYCCMZDVLX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.94 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |