C26H23ClN2O5S — CID 78252488
7-chloro-2-(6-methoxy-1,3-benzothiazol-2-yl)-1-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78252488) has the molecular formula C26H23ClN2O5S and a molecular weight of 511.00 g/mol. Its IUPAC name is 7-chloro-2-(6-methoxy-1,3-benzothiazol-2-yl)-1-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(6-methoxy-1,3-benzothiazol-2-yl)-1-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78252488 |
| Molecular Formula | C26H23ClN2O5S |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | 7-chloro-2-(6-methoxy-1,3-benzothiazol-2-yl)-1-(4-methoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(C2C3=C(OC4CCC(Cl)CC4C3=O)C(=O)N2c2nc3ccc(OC)cc3s2)cc1 |
| InChI | InChI=1S/C26H23ClN2O5S/c1-32-15-6-3-13(4-7-15)22-21-23(30)17-11-14(27)5-10-19(17)34-24(21)25(31)29(22)26-28-18-9-8-16(33-2)12-20(18)35-26/h3-4,6-9,12,14,17,19,22H,5,10-11H2,1-2H3 |
| InChIKey | IZDQMUIPVRSXBF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|