C26H23FN2O3S — CID 78252534
2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78252534) has the molecular formula C26H23FN2O3S and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78252534 |
| Molecular Formula | C26H23FN2O3S |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 2-(4,6-dimethyl-1,3-benzothiazol-2-yl)-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1cc(C)c2nc(N3C(=O)C4=C(C(=O)C5CCCCC5O4)C3c3ccc(F)cc3)sc2c1 |
| InChI | InChI=1S/C26H23FN2O3S/c1-13-11-14(2)21-19(12-13)33-26(28-21)29-22(15-7-9-16(27)10-8-15)20-23(30)17-5-3-4-6-18(17)32-24(20)25(29)31/h7-12,17-18,22H,3-6H2,1-2H3 |
| InChIKey | QYXUZXWTGHNGHO-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |