C21H19ClFN3O3S — CID 78254935
7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78254935) has the molecular formula C21H19ClFN3O3S and a molecular weight of 447.92 g/mol. Its IUPAC name is 7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78254935 |
| Molecular Formula | C21H19ClFN3O3S |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 7-chloro-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-1-(3-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1nnc(N2C(=O)C3=C(C(=O)C4CC(Cl)CCC4O3)C2c2cccc(F)c2)s1 |
| InChI | InChI=1S/C21H19ClFN3O3S/c1-2-15-24-25-21(30-15)26-17(10-4-3-5-12(23)8-10)16-18(27)13-9-11(22)6-7-14(13)29-19(16)20(26)28/h3-5,8,11,13-14,17H,2,6-7,9H2,1H3 |
| InChIKey | IBKWZQTUYUSTII-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|