C24H26FN3O5S — CID 73260709
1-(3,4-dimethoxyphenyl)-7-fluoro-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73260709) has the molecular formula C24H26FN3O5S and a molecular weight of 487.55 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-7-fluoro-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3,4-dimethoxyphenyl)-7-fluoro-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73260709 |
| Molecular Formula | C24H26FN3O5S |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-7-fluoro-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCc1nnc(N2C(=O)C3=C(C(=O)C4CC(F)CCC4O3)C2c2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C24H26FN3O5S/c1-4-5-18-26-27-24(34-18)28-20(12-6-8-16(31-2)17(10-12)32-3)19-21(29)14-11-13(25)7-9-15(14)33-22(19)23(28)30/h6,8,10,13-15,20H,4-5,7,9,11H2,1-3H3 |
| InChIKey | FOXYHGQDRZZRKP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |