C22H21F2N3O3S — CID 73260508
7-fluoro-1-(2-fluorophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73260508) has the molecular formula C22H21F2N3O3S and a molecular weight of 445.49 g/mol. Its IUPAC name is 7-fluoro-1-(2-fluorophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-fluoro-1-(2-fluorophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73260508 |
| Molecular Formula | C22H21F2N3O3S |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 7-fluoro-1-(2-fluorophenyl)-2-(5-propyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCc1nnc(N2C(=O)C3=C(C(=O)C4CC(F)CCC4O3)C2c2ccccc2F)s1 |
| InChI | InChI=1S/C22H21F2N3O3S/c1-2-5-16-25-26-22(31-16)27-18(12-6-3-4-7-14(12)24)17-19(28)13-10-11(23)8-9-15(13)30-20(17)21(27)29/h3-4,6-7,11,13,15,18H,2,5,8-10H2,1H3 |
| InChIKey | CIJLMSLCQWWKEL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |