C27H32FN3O3S — CID 78254370
1-(4-tert-butylphenyl)-7-fluoro-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78254370) has the molecular formula C27H32FN3O3S and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-7-fluoro-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-tert-butylphenyl)-7-fluoro-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78254370 |
| Molecular Formula | C27H32FN3O3S |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 1-(4-tert-butylphenyl)-7-fluoro-2-[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC(C)Cc1nnc(N2C(=O)C3=C(C(=O)C4CC(F)CCC4O3)C2c2ccc(C(C)(C)C)cc2)s1 |
| InChI | InChI=1S/C27H32FN3O3S/c1-14(2)12-20-29-30-26(35-20)31-22(15-6-8-16(9-7-15)27(3,4)5)21-23(32)18-13-17(28)10-11-19(18)34-24(21)25(31)33/h6-9,14,17-19,22H,10-13H2,1-5H3 |
| InChIKey | OOSUTENPFKYCLV-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |