C23H24ClN3O5S — CID 78254542
7-chloro-1-(3,4-dimethoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78254542) has the molecular formula C23H24ClN3O5S and a molecular weight of 489.98 g/mol. Its IUPAC name is 7-chloro-1-(3,4-dimethoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-1-(3,4-dimethoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78254542 |
| Molecular Formula | C23H24ClN3O5S |
| Molecular Weight | 489.98 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 7-chloro-1-(3,4-dimethoxyphenyl)-2-(5-ethyl-1,3,4-thiadiazol-2-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCc1nnc(N2C(=O)C3=C(C(=O)C4CC(Cl)CCC4O3)C2c2ccc(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C23H24ClN3O5S/c1-4-17-25-26-23(33-17)27-19(11-5-7-15(30-2)16(9-11)31-3)18-20(28)13-10-12(24)6-8-14(13)32-21(18)22(27)29/h5,7,9,12-14,19H,4,6,8,10H2,1-3H3 |
| InChIKey | SVYDZPRRTQZEMC-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 90.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.98 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|