C27H27ClFNO5 — CID 78254249
7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78254249) has the molecular formula C27H27ClFNO5 and a molecular weight of 499.97 g/mol. Its IUPAC name is 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78254249 |
| Molecular Formula | C27H27ClFNO5 |
| Molecular Weight | 499.97 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 7-chloro-2-[2-(3,4-dimethoxyphenyl)ethyl]-1-(4-fluorophenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | COc1ccc(CCN2C(=O)C3=C(C(=O)C4CC(Cl)CCC4O3)C2c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C27H27ClFNO5/c1-33-21-9-3-15(13-22(21)34-2)11-12-30-24(16-4-7-18(29)8-5-16)23-25(31)19-14-17(28)6-10-20(19)35-26(23)27(30)32/h3-5,7-9,13,17,19-20,24H,6,10-12,14H2,1-2H3 |
| InChIKey | RLRZQMKJEQPIPW-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.97 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|