C26H33NO7S — CID 73262762
1-(4-butoxy-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73262762) has the molecular formula C26H33NO7S and a molecular weight of 503.62 g/mol. Its IUPAC name is 1-(4-butoxy-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(4-butoxy-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73262762 |
| Molecular Formula | C26H33NO7S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | 1-(4-butoxy-3-methoxyphenyl)-2-(1,1-dioxothiolan-3-yl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CCCCOc1ccc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2C2CCS(=O)(=O)C2)cc1OC |
| InChI | InChI=1S/C26H33NO7S/c1-3-4-12-33-20-10-9-16(14-21(20)32-2)23-22-24(28)18-7-5-6-8-19(18)34-25(22)26(29)27(23)17-11-13-35(30,31)15-17/h9-10,14,17-19,23H,3-8,11-13,15H2,1-2H3 |
| InChIKey | HDJCIWXIABGCQO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|