C23H28Cl2N2O3 — CID 74759366
1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 74759366) has the molecular formula C23H28Cl2N2O3 and a molecular weight of 451.39 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 74759366 |
| Molecular Formula | C23H28Cl2N2O3 |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-[2-(dimethylamino)ethyl]-6,7-dimethyl-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC1CC2OC3=C(C(=O)C2CC1C)C(c1ccc(Cl)c(Cl)c1)N(CCN(C)C)C3=O |
| InChI | InChI=1S/C23H28Cl2N2O3/c1-12-9-15-18(10-13(12)2)30-22-19(21(15)28)20(14-5-6-16(24)17(25)11-14)27(23(22)29)8-7-26(3)4/h5-6,11-13,15,18,20H,7-10H2,1-4H3 |
| InChIKey | DBNPRXQTBKMYBZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |