C24H31ClN2O3 — CID 73263685
7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(4-methylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73263685) has the molecular formula C24H31ClN2O3 and a molecular weight of 430.98 g/mol. Its IUPAC name is 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(4-methylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(4-methylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73263685 |
| Molecular Formula | C24H31ClN2O3 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 7-chloro-2-[3-(dimethylamino)propyl]-6-methyl-1-(4-methylphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | Cc1ccc(C2C3=C(OC4CC(C)C(Cl)CC4C3=O)C(=O)N2CCCN(C)C)cc1 |
| InChI | InChI=1S/C24H31ClN2O3/c1-14-6-8-16(9-7-14)21-20-22(28)17-13-18(25)15(2)12-19(17)30-23(20)24(29)27(21)11-5-10-26(3)4/h6-9,15,17-19,21H,5,10-13H2,1-4H3 |
| InChIKey | QRNLIFDIYLJDMZ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|