C23H25ClN4O4S — CID 73220655
2-[[6-(1,3-benzodioxol-5-ylmethyl)-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide (PubChem CID 73220655) has the molecular formula C23H25ClN4O4S and a molecular weight of 489.00 g/mol. Its IUPAC name is 2-[[6-(1,3-benzodioxol-5-ylmethyl)-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-[[6-(1,3-benzodioxol-5-ylmethyl)-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 73220655 |
| Molecular Formula | C23H25ClN4O4S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | 2-[[6-(1,3-benzodioxol-5-ylmethyl)-4-oxo-1,2,3,4a,5,7,8,8a-octahydropyrido[4,3-d]pyrimidin-2-yl]sulfanyl]-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CSC1NC(=O)C2CN(Cc3ccc4c(c3)OCO4)CCC2N1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H25ClN4O4S/c24-15-2-1-3-16(9-15)25-21(29)12-33-23-26-18-6-7-28(11-17(18)22(30)27-23)10-14-4-5-19-20(8-14)32-13-31-19/h1-5,8-9,17-18,23,26H,6-7,10-13H2,(H,25,29)(H,27,30) |
| InChIKey | ROFNCXHTSMCFLI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |