C21H29NO2 — CID 7323246
(3aR,7aR)-2-[2-(1-adamantyl)ethyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7323246) has the molecular formula C21H29NO2 and a molecular weight of 327.47 g/mol. Its IUPAC name is (3aR,7aR)-2-[2-(1-adamantyl)ethyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[2-(1-adamantyl)ethyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7323246 |
| Molecular Formula | C21H29NO2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | (3aR,7aR)-2-[2-(1-adamantyl)ethyl]-5-methyl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CC[C@H]2C(=O)N(CCC34CC5CC(CC(C5)C3)C4)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C21H29NO2/c1-13-2-3-17-18(6-13)20(24)22(19(17)23)5-4-21-10-14-7-15(11-21)9-16(8-14)12-21/h2,14-18H,3-12H2,1H3/t14?,15?,16?,17-,18-,21?/m1/s1 |
| InChIKey | ADRMBVOXEALUIY-GRIAEXQCSA-N |
| XLogP | 3.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|