C23H27N3O3 — CID 73250368
2-methoxy-N-[2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)phenyl]-2-phenylacetamide (PubChem CID 73250368) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-methoxy-N-[2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)phenyl]-2-phenylacetamide.
| Compound Name | 2-methoxy-N-[2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 73250368 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-methoxy-N-[2-(3-oxo-2,4,4a,5,6,7,8,8a-octahydro-1H-quinoxalin-2-yl)phenyl]-2-phenylacetamide |
| SMILES | COC(C(=O)Nc1ccccc1C1NC2CCCCC2NC1=O)c1ccccc1 |
| InChI | InChI=1S/C23H27N3O3/c1-29-21(15-9-3-2-4-10-15)23(28)25-17-12-6-5-11-16(17)20-22(27)26-19-14-8-7-13-18(19)24-20/h2-6,9-12,18-21,24H,7-8,13-14H2,1H3,(H,25,28)(H,26,27) |
| InChIKey | YKBUVTPYERTRFF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |