C23H26N2O4 — CID 7325225
methyl (2R)-4-methyl-2-[[5-(3-methylphenoxy)-1H-indole-2-carbonyl]amino]pentanoate (PubChem CID 7325225) has the molecular formula C23H26N2O4 and a molecular weight of 394.47 g/mol. Its IUPAC name is methyl (2R)-4-methyl-2-[[5-(3-methylphenoxy)-1H-indole-2-carbonyl]amino]pentanoate.
| Compound Name | methyl (2R)-4-methyl-2-[[5-(3-methylphenoxy)-1H-indole-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 7325225 |
| Molecular Formula | C23H26N2O4 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | methyl (2R)-4-methyl-2-[[5-(3-methylphenoxy)-1H-indole-2-carbonyl]amino]pentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)c1cc2cc(Oc3cccc(C)c3)ccc2[nH]1 |
| InChI | InChI=1S/C23H26N2O4/c1-14(2)10-21(23(27)28-4)25-22(26)20-13-16-12-18(8-9-19(16)24-20)29-17-7-5-6-15(3)11-17/h5-9,11-14,21,24H,10H2,1-4H3,(H,25,26)/t21-/m1/s1 |
| InChIKey | QPAAVTQXJJKZQJ-OAQYLSRUSA-N |
| XLogP | 4.59 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |