C25H29N3O5 — CID 20604417
methyl (2S)-2-[[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]amino]-3-phenylpropanoate (PubChem CID 20604417) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is methyl (2S)-2-[[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 20604417 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | methyl (2S)-2-[[5-(2-morpholin-4-ylethoxy)-1H-indole-2-carbonyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cc2cc(OCCN3CCOCC3)ccc2[nH]1 |
| InChI | InChI=1S/C25H29N3O5/c1-31-25(30)23(15-18-5-3-2-4-6-18)27-24(29)22-17-19-16-20(7-8-21(19)26-22)33-14-11-28-9-12-32-13-10-28/h2-8,16-17,23,26H,9-15H2,1H3,(H,27,29)/t23-/m0/s1 |
| InChIKey | JJKLYEHQZCIMHY-QHCPKHFHSA-N |
| XLogP | 2.39 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |