C18H16ClN3O3 — CID 73254440
5-chloro-N-(2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxamide (PubChem CID 73254440) has the molecular formula C18H16ClN3O3 and a molecular weight of 357.80 g/mol. Its IUPAC name is 5-chloro-N-(2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxamide.
| Compound Name | 5-chloro-N-(2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 73254440 |
| Molecular Formula | C18H16ClN3O3 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 5-chloro-N-(2,4-dimethoxyphenyl)-1-phenylpyrazole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cnn(-c3ccccc3)c2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H16ClN3O3/c1-24-13-8-9-15(16(10-13)25-2)21-18(23)14-11-20-22(17(14)19)12-6-4-3-5-7-12/h3-11H,1-2H3,(H,21,23) |
| InChIKey | VIZJPLWQTVCGOV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |