C26H29N3O4 — CID 73256572
ethyl 4-[(5',7'-dimethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carbonyl)amino]benzoate (PubChem CID 73256572) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 4-[(5',7'-dimethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carbonyl)amino]benzoate.
| Compound Name | ethyl 4-[(5',7'-dimethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 73256572 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | ethyl 4-[(5',7'-dimethyl-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-2-carbonyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C2CC3CCCN3C23C(=O)Nc2c(C)cc(C)cc23)cc1 |
| InChI | InChI=1S/C26H29N3O4/c1-4-33-24(31)17-7-9-18(10-8-17)27-23(30)21-14-19-6-5-11-29(19)26(21)20-13-15(2)12-16(3)22(20)28-25(26)32/h7-10,12-13,19,21H,4-6,11,14H2,1-3H3,(H,27,30)(H,28,32) |
| InChIKey | HIYMQBNHSINOIA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |