C19H23N3O2S2 — CID 73257235
3-butyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 73257235) has the molecular formula C19H23N3O2S2 and a molecular weight of 389.55 g/mol. Its IUPAC name is 3-butyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-butyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 73257235 |
| Molecular Formula | C19H23N3O2S2 |
| Molecular Weight | 389.55 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 3-butyl-5-[(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCCCN1C(=O)C(=CN2CC3CC(C2)c2cccc(=O)n2C3)SC1=S |
| InChI | InChI=1S/C19H23N3O2S2/c1-2-3-7-21-18(24)16(26-19(21)25)12-20-9-13-8-14(11-20)15-5-4-6-17(23)22(15)10-13/h4-6,12-14H,2-3,7-11H2,1H3 |
| InChIKey | FDQNUJSHAAFABS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|