C12H8ClN7OS — CID 73258630
3-[[1-(4-chlorophenyl)tetrazol-5-yl]methylsulfanyl]-6-methylidene-1,2,4-triazin-5-one (PubChem CID 73258630) has the molecular formula C12H8ClN7OS and a molecular weight of 333.76 g/mol. Its IUPAC name is 3-[[1-(4-chlorophenyl)tetrazol-5-yl]methylsulfanyl]-6-methylidene-1,2,4-triazin-5-one.
| Compound Name | 3-[[1-(4-chlorophenyl)tetrazol-5-yl]methylsulfanyl]-6-methylidene-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 73258630 |
| Molecular Formula | C12H8ClN7OS |
| Molecular Weight | 333.76 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-[[1-(4-chlorophenyl)tetrazol-5-yl]methylsulfanyl]-6-methylidene-1,2,4-triazin-5-one |
| SMILES | C=C1N=NC(SCc2nnnn2-c2ccc(Cl)cc2)=NC1=O |
| InChI | InChI=1S/C12H8ClN7OS/c1-7-11(21)14-12(17-15-7)22-6-10-16-18-19-20(10)9-4-2-8(13)3-5-9/h2-5H,1,6H2 |
| InChIKey | DOIKMHCBVNLZLL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 97.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.76 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|