C26H33FN2O4 — CID 73260488
1-(2-fluorophenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 73260488) has the molecular formula C26H33FN2O4 and a molecular weight of 456.56 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 1-(2-fluorophenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 73260488 |
| Molecular Formula | C26H33FN2O4 |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 1-(2-fluorophenyl)-6,7-dimethyl-2-(3-morpholin-4-ylpropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC1CC2OC3=C(C(=O)C2CC1C)C(c1ccccc1F)N(CCCN1CCOCC1)C3=O |
| InChI | InChI=1S/C26H33FN2O4/c1-16-14-19-21(15-17(16)2)33-25-22(24(19)30)23(18-6-3-4-7-20(18)27)29(26(25)31)9-5-8-28-10-12-32-13-11-28/h3-4,6-7,16-17,19,21,23H,5,8-15H2,1-2H3 |
| InChIKey | LAOJFGBWGVBVBF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |