C23H27BrFNO4 — CID 78255949
7-bromo-1-(2-fluorophenyl)-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione (PubChem CID 78255949) has the molecular formula C23H27BrFNO4 and a molecular weight of 480.37 g/mol. Its IUPAC name is 7-bromo-1-(2-fluorophenyl)-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione.
| Compound Name | 7-bromo-1-(2-fluorophenyl)-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
|---|---|
| PubChem CID | 78255949 |
| Molecular Formula | C23H27BrFNO4 |
| Molecular Weight | 480.37 g/mol |
| Exact Mass | 479.11 |
| IUPAC Name | 7-bromo-1-(2-fluorophenyl)-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione |
| SMILES | CC(C)OCCCN1C(=O)C2=C(C(=O)C3CC(Br)CCC3O2)C1c1ccccc1F |
| InChI | InChI=1S/C23H27BrFNO4/c1-13(2)29-11-5-10-26-20(15-6-3-4-7-17(15)25)19-21(27)16-12-14(24)8-9-18(16)30-22(19)23(26)28/h3-4,6-7,13-14,16,18,20H,5,8-12H2,1-2H3 |
| InChIKey | CNYDPXKLHAPQBH-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|