C25H30FNO6 — CID 78254498
methyl 4-[7-fluoro-3,9-dioxo-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate (PubChem CID 78254498) has the molecular formula C25H30FNO6 and a molecular weight of 459.51 g/mol. Its IUPAC name is methyl 4-[7-fluoro-3,9-dioxo-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate.
| Compound Name | methyl 4-[7-fluoro-3,9-dioxo-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 78254498 |
| Molecular Formula | C25H30FNO6 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | methyl 4-[7-fluoro-3,9-dioxo-2-(3-propan-2-yloxypropyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(OC4CCC(F)CC4C3=O)C(=O)N2CCCOC(C)C)cc1 |
| InChI | InChI=1S/C25H30FNO6/c1-14(2)32-12-4-11-27-21(15-5-7-16(8-6-15)25(30)31-3)20-22(28)18-13-17(26)9-10-19(18)33-23(20)24(27)29/h5-8,14,17-19,21H,4,9-13H2,1-3H3 |
| InChIKey | OOVLXQQCDPXZNU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|