C26H27BrN2O7 — CID 73263843
methyl 4-[3-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 73263843) has the molecular formula C26H27BrN2O7 and a molecular weight of 559.41 g/mol. Its IUPAC name is methyl 4-[3-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[3-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 73263843 |
| Molecular Formula | C26H27BrN2O7 |
| Molecular Weight | 559.41 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | methyl 4-[3-[(5-bromo-2-hydroxyphenyl)-hydroxymethylidene]-1-(3-morpholin-4-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C(=C(O)c3cc(Br)ccc3O)C(=O)C(=O)N2CCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C26H27BrN2O7/c1-35-26(34)17-5-3-16(4-6-17)22-21(23(31)19-15-18(27)7-8-20(19)30)24(32)25(33)29(22)10-2-9-28-11-13-36-14-12-28/h3-8,15,22,30-31H,2,9-14H2,1H3 |
| InChIKey | BKIHCVHJBFCZMA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|