C16H17N3O2S — CID 73264338
6-amino-2-(2-naphthalen-1-yl-2-oxoethyl)sulfanyl-1,3-diazinan-4-one (PubChem CID 73264338) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 6-amino-2-(2-naphthalen-1-yl-2-oxoethyl)sulfanyl-1,3-diazinan-4-one.
| Compound Name | 6-amino-2-(2-naphthalen-1-yl-2-oxoethyl)sulfanyl-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 73264338 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 6-amino-2-(2-naphthalen-1-yl-2-oxoethyl)sulfanyl-1,3-diazinan-4-one |
| SMILES | NC1CC(=O)NC(SCC(=O)c2cccc3ccccc23)N1 |
| InChI | InChI=1S/C16H17N3O2S/c17-14-8-15(21)19-16(18-14)22-9-13(20)12-7-3-5-10-4-1-2-6-11(10)12/h1-7,14,16,18H,8-9,17H2,(H,19,21) |
| InChIKey | NASXVUIQNVZMGH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |