C11H14BrN3OS — CID 78223760
6-amino-2-[(3-bromophenyl)methylsulfanyl]-1,3-diazinan-4-one (PubChem CID 78223760) has the molecular formula C11H14BrN3OS and a molecular weight of 316.22 g/mol. Its IUPAC name is 6-amino-2-[(3-bromophenyl)methylsulfanyl]-1,3-diazinan-4-one.
| Compound Name | 6-amino-2-[(3-bromophenyl)methylsulfanyl]-1,3-diazinan-4-one |
|---|---|
| PubChem CID | 78223760 |
| Molecular Formula | C11H14BrN3OS |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 6-amino-2-[(3-bromophenyl)methylsulfanyl]-1,3-diazinan-4-one |
| SMILES | NC1CC(=O)NC(SCc2cccc(Br)c2)N1 |
| InChI | InChI=1S/C11H14BrN3OS/c12-8-3-1-2-7(4-8)6-17-11-14-9(13)5-10(16)15-11/h1-4,9,11,14H,5-6,13H2,(H,15,16) |
| InChIKey | JHYIRVKSTWEYPX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |