C22H27N5O — CID 7326555
1-[3,5-bis[(4-methylphenyl)methylamino]-1,2,4-triazol-1-yl]butan-1-one (PubChem CID 7326555) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-[3,5-bis[(4-methylphenyl)methylamino]-1,2,4-triazol-1-yl]butan-1-one.
| Compound Name | 1-[3,5-bis[(4-methylphenyl)methylamino]-1,2,4-triazol-1-yl]butan-1-one |
|---|---|
| PubChem CID | 7326555 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 1-[3,5-bis[(4-methylphenyl)methylamino]-1,2,4-triazol-1-yl]butan-1-one |
| SMILES | CCCC(=O)n1nc(NCc2ccc(C)cc2)nc1NCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-4-5-20(28)27-22(24-15-19-12-8-17(3)9-13-19)25-21(26-27)23-14-18-10-6-16(2)7-11-18/h6-13H,4-5,14-15H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | XHQXUKHQCAKHEB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |