C19H27N2OS+ — CID 7327186
[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-[(2R)-butan-2-yl]azanium (PubChem CID 7327186) has the molecular formula C19H27N2OS+ and a molecular weight of 331.50 g/mol. Its IUPAC name is [2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-[(2R)-butan-2-yl]azanium.
| Compound Name | [2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-[(2R)-butan-2-yl]azanium |
|---|---|
| PubChem CID | 7327186 |
| Molecular Formula | C19H27N2OS+ |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | [2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-[(2R)-butan-2-yl]azanium |
| SMILES | CC[C@@H](C)[NH2+]CC(=O)N(Cc1ccccc1)Cc1sccc1C |
| InChI | InChI=1S/C19H26N2OS/c1-4-16(3)20-12-19(22)21(13-17-8-6-5-7-9-17)14-18-15(2)10-11-23-18/h5-11,16,20H,4,12-14H2,1-3H3/p+1/t16-/m1/s1 |
| InChIKey | MMQPLSRRFGVZCB-MRXNPFEDSA-O |
| XLogP | 2.95 |
| TPSA | 36.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |