C21H20N4O2 — CID 7328174
(3S,4S)-N-[(E)-(1-methylindol-3-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide (PubChem CID 7328174) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (3S,4S)-N-[(E)-(1-methylindol-3-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide.
| Compound Name | (3S,4S)-N-[(E)-(1-methylindol-3-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 7328174 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (3S,4S)-N-[(E)-(1-methylindol-3-yl)methylideneamino]-2-oxo-4-phenylpyrrolidine-3-carboxamide |
| SMILES | Cn1cc(/C=N/NC(=O)[C@@H]2C(=O)NC[C@@H]2c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C21H20N4O2/c1-25-13-15(16-9-5-6-10-18(16)25)11-23-24-21(27)19-17(12-22-20(19)26)14-7-3-2-4-8-14/h2-11,13,17,19H,12H2,1H3,(H,22,26)(H,24,27)/b23-11+/t17-,19+/m1/s1 |
| InChIKey | WAEDZPPPYBMMNB-VABFBZKRSA-N |
| XLogP | 2.16 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|