C22H32N6O2 — CID 73284328
3-tert-butyl-7,9-dimethyl-1-(3-phenylpropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione (PubChem CID 73284328) has the molecular formula C22H32N6O2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 3-tert-butyl-7,9-dimethyl-1-(3-phenylpropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione.
| Compound Name | 3-tert-butyl-7,9-dimethyl-1-(3-phenylpropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
|---|---|
| PubChem CID | 73284328 |
| Molecular Formula | C22H32N6O2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 3-tert-butyl-7,9-dimethyl-1-(3-phenylpropyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione |
| SMILES | CN1C(=O)C2C(NC3N(CCCc4ccccc4)N=C(C(C)(C)C)CN23)N(C)C1=O |
| InChI | InChI=1S/C22H32N6O2/c1-22(2,3)16-14-27-17-18(25(4)21(30)26(5)19(17)29)23-20(27)28(24-16)13-9-12-15-10-7-6-8-11-15/h6-8,10-11,17-18,20,23H,9,12-14H2,1-5H3 |
| InChIKey | HBNVLZIBGQGUOW-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |